0

Depletion of ozone layer - class-X

Attempted 0/68 Correct 0 Score 0

Greenhouse effect is due to

  1. accumulation of $ { O } _{ 3 } $ and depletion of $ { CO } _{ 2 } $

  2. accumulation of both $ { O } _{ 3 } $ and $ { CO } _{ 2 } $

  3. accumulation of $ { CO } _{ 2 } $ and depletion of $ { O } _{ 3 } $

  4. presence of green plants on the Earth.


Correct Option: C
Explanation:
Greenhouse effect, a warming of Earth’s surface and troposphere (the lowest layer of the atmosphere) is caused by the presence of water vapour, carbon dioxide, methane, and certain other gases in the air. Of those gases, known as greenhouse gases, water vapour has the largest effect. The atmosphere allows most of the visible light from the Sun to pass through and reach Earth’s surface. As Earth’s surface is heated by sunlight, it radiates part of this energy back toward space as infrared radiation. This radiation, unlike visible light, tends to be absorbed by the greenhouse gases in the atmosphere, raising its temperature. The heated atmosphere in turn radiates infrared radiation back toward Earth’s surface. 
So the correct option is 'accumulation of CO$ _2$ and depletion of O$ _3$'.

Read the given statements and select the correct option.


Statement 1: The average temperature of Earth has increased by $ 0.6 $ during the past century.
Statement 2: There has been a progressive increase in the use of fossil fuels generating more greenhouse gases.

  1. Both statements 1 and 2 are correct.

  2. Statement 1 is correct but statement 2 is incorrect.

  3. Statement 1 is incorrect but statement 2 is correct.

  4. Both statements 1 and 2 are incorrect.


Correct Option: A
Explanation:

The various greenhouse gases are $ { CO } _{ 2 }, { CH } _{ 4 }, { CFC } _{ s } $ and $ { N } _{ 2 }{ O } $. Excessive use of fossil fuel is adding more $ { CO } _{ 2 } $ to atmosphere. This increase in concentration of greenhouse gases has led to considerable heating of earth leading to global warming. During the pas century, the temperature of earth has increased by $ 0.6 $.

Identify the incorrect statement from the following

  1. Oxides of nitrogen in the atmosphere can cause the depletion of ozone layer

  2. Ozone absorbs the intense ultraviolet radiations of the sun

  3. Depletion of ozone layer is because of its chemical reactions with  CFC

  4. Ozone absorbs infrared radiations


Correct Option: D
Explanation:

Ozone doesn't absorb infrared radiation , it absorbs ultraviolet radiations .

Which of the following is not a greenhouse gas?

  1. Methane $CH _4$

  2. Ozone $O _3$

  3. Oxygen $O _2$

  4. Carbon dioxide $CO _2$


Correct Option: C
Explanation:

Oxygen is not greenhouse gas, because they are transparent to infrared light.

In absence of Green House Gases, the temperature of Earth shall fall down to ___

  1. -18 degree Celcius

  2. -15 degree Celcius

  3. -20 degree Celcius

  4. -10 degree Celcius


Correct Option: A
Explanation:

Because Green House Gases are responsible to trap heat in earth surface. If green house gases are absent, the temperature of Earth shall fall down to -18 degree Celcius

So, the correct answer is '-18$^0$

Correct percentage of two green house gases is

  1. $N _2O-6\%, CO _2-86\%$

  2. $CH _4-20\%, N _2O-18\%$

  3. $CO _2-40\%, CFC-30\%$

  4. $CFC-14\%, CH _4-20\%$


Correct Option: D
Explanation:
The warming of earth's surface when sun radiations are absorbed and trapped in earth's atmosphere, is called greenhouse effect. The gases responsible for green house effect are called green house gases which trap the radiations and don't let them reflect back from the earth's surface. The green house gases are Chlorofluorocarbons (CFC's), Carbon dioxide (CO2), Methane (CH4) and Nitrous Oxide (N2O). 
The approximate percentage of different greenhouse gases in the atmosphere is:
CFCs - 14%
CO2 - 60%
‎CH4 - 20%
N2O - 6%
So, the correct answer is 'CFC14%, CH4 - 20%

Which of the following is a green house gas?

  1. Methane

  2. CO

  3. Water vapour

  4. Oxygen


Correct Option: A
Explanation:
The warming of earth's surface when sun radiations are absorbed and trapped in earth's atmosphere, is called greenhouse effect. The gases responsible for green house effect are called green house gases which trap the radiations and don't let them reflect back from the earth's surface. The green house gases are Chlorofluorocarbons (CFCs), Carbon dioxide (CO2), Methane (CH4) and Nitrous Oxide (N2O). 
So, the correct answer is 'Methane'.

Carbon dioxide is called a green house gas because

  1. It emits light

  2. It traps infra red radiations

  3. It traps ultraviolet radiations

  4. It is involved in photosynthesis


Correct Option: B
Explanation:
The warming of earth's surface when sun radiations are absorbed and trapped in earth's atmosphere, is called greenhouse effect. The gases responsible for green house effect are called green house gases which trap the radiations and don't let them reflect back from the earth's surface. Carbon dioxide traps the infra red radiations and accounts for greatest contribution to greenhouse effect.
So, the correct answer is 'It traps infra red radiations'.

Which greenhouse gas contributes 20% to global warming?

  1. Methane

  2. N$ _2$O

  3. CFCs

  4. CO$ _2$


Correct Option: A
Explanation:
he gases responsible for green house effect are called green house gases which trap the radiations and don't let them reflect back from the earth's surface. The green house gases are Chlorofluorocarbons (CFC's), Carbon dioxide (CO2), Methane (CH4) and Nitrous Oxide (N2O). 
The approximate percentage of different greenhouse gases in the atmosphere is:
CFCs - 14%
CO2 - 60%
‎CH4 - 20%
N2O - 6%
So, the correct answer is 'Methane'.

Earth is kept warm due to green house flux.

  1. True

  2. False


Correct Option: A
Explanation:
Greenhouse flux occurs due to the accumulation of greenhouse gases. Gases like carbon dioxide, methane, nitrous oxide trap radiations and absorb the light. The energy gets trapped in the earth and this causes a rise in temperature of the earth causing it to become warmer. This is called the greenhouse effect. Carbon dioxide has a maximum contribution in the greenhouse effect. It also maintains optimum earth temperature as less concentration of carbon dioxide will lead to loss of heat from earth causing a decrease in temperature. However, excess concentration of carbon dioxide can lead to an increase in earth's temperature causing global warming.
Hence, the statement given in the question is correct.
So, the correct answer is 'True'.

$CO _2$ absorbs some of the ....... that radiates from the surface of Earth to space

  1. ozone

  2. heat

  3. ultraviolet light

  4. smog


Correct Option: B
Explanation:
CO2 is a greenhouse gas. When radiations of the sun reach earth, they are reflected back from the earth's surface. CO2 absorbs some of the radiation and prevents it from getting escaped due to which the temperature of earth rises. This is called the greenhouse effect. Excess concentration of CO2 thus, can lead to an abnormal increase in earth's temperature and cause global warming. 
So, the correct answer is 'heat'.

Gases commonly referred as green house gases are :

  1. $CH _4$

  2. $CO _2$

  3. CFC

  4. $NH _3$


Correct Option: A,B,C
Explanation:
Greenhouse gases absorbs radiations from sun that are reflected back from earth's surface. In this way, they prevent the radiations from escaping. These gases can cause greenhouse effect in which there is warming of earth's surface. Gases like methane (CH4), carbon dioxide (CO2), CFC (Chlorofluorocarbon) and Nitrous oxide (N2O) are greenhouse gases. Excess concentration of greenhouse gases in atmosphere can cause global warming.
So, the correct answer is options 'A, B and C'. 

The main green house gas is

  1. Ozone

  2. Oxygen

  3. Helium

  4. Cardon dioxide


Correct Option: D
Explanation:

Greenhouse gases are the gases that contribute to the greenhouse effect by absorbing the earth's heat and re-radiating it towards the earth. Carbon dioxide is the highest (among gases) contributor towards greenhouse effect and contributes about 9-26%, followed by methane (contributes 4-9%), and ozone (3-7%). Over the past few years, carbon dioxide has caused most of the global warming as it is present in abundance in the atmosphere and its amount is increasing over the years. So, even though other gases have a more contributing effect per molecule, the amount of carbon dioxide is so high that it contributes more than the other gases. Due to this carbon dioxide is considered the main greenhouse gas. 

Thus, the correct answer is 'Carbon dioxide.' 

The true statement about 'Green -house effect' is that it is

  1. Caused by combination of many gases

  2. Caused only by $CO _2$

  3. Caused by $CO _2,CFC,CH _4$ and $NO _2$ gases

  4. None of the above


Correct Option: A
Explanation:
Greenhouse effect is the phenomenon in which radiations from the sun are trapped in the earth's surface and this causes the warming of surface and increase in temperature of earth. Various gases such as carbon dioxide and carbon monoxide trap the heat radiations that enter the earth's surface and promotes greenhouse effect. Such gases are called greenhouse gases. Approximate contribution of different gases to greenhouse effect is as follows:
  • Carbon dioxide (CO2)- 60%
  • Methane (CH4)- 20%
  • Chlorofluorocarbons (CFC)- 14%
  • Nitrous oxide (N2O)- 6%
Hence, greenhouse effect is caused by combination of many gases.
So, the correct answer is 'Caused by combination of many gases'.

Whale washed ashore will die because of?

  1. Increase in body temperature

  2. Incapability to breathe

  3. Crushing of bones under body weight

  4. Cracking skin


Correct Option: A
Explanation:

Avails cannot try photo photo there are number of various reasons why they are unable to live on land first of all their bodies are not designed to hold the weight on the land which is unknown by and environment secondly they have a thick layer of blubber which is fatty tissue and lack of water well quickly overheat get dehydrated and try out the temperature of the water is essential for the survival correct option is increasing body temperature

Green house gases of the following

  1. $CO, CO _2$

  2. $SO _2, CO _2$

  3. $CO _2$ methane

  4. Co and Methane


Correct Option: A

What is the man-made green house gas known as?

  1. Carbon dioxide

  2. HFC

  3. Ozone

  4. Water Vapour


Correct Option: B

The most abundant greenhouse gas in the earth's atmosphere:

  1. Carbon dioxide $(CO _{2})$

  2. Nitrous oxide $(N _{2}O)$

  3. Water vapor $(H _{2}O)$

  4. Methane $(CH _{4})$


Correct Option: C

The green house gases, otherwise called radioactively active gases includes

  1. Carbon dioxide

  2. $CH _{4}$

  3. $N _{2}O$

  4. All of these


Correct Option: D

___________ is the phenomenon where the earth retains heat.

  1. Air pollution

  2. Green house effect

  3. Global effect

  4. Land pollution


Correct Option: B

Which two gases are most responsible for greenhouse effect?

  1. Water vapour

  2. Carbon dioxide

  3. Argon

  4. Both a and b


Correct Option: D

Chemical substances that increase earth's surface temperature is known as

  1. Green house gases

  2. Global warming

  3. Climate change

  4. Urbanization


Correct Option: A

Which gas plays a major role in global warming?

  1. Carbon monoxide

  2. Nitrogen

  3. Carbon dioxide

  4. Sulphur dioxide


Correct Option: C
Explanation:

The warming up of the atmosphere due to trapped radiation is called green house effect. Green house gases like carbon dioxide, methane, nitrous oxide etc; increase in green house gases leads to global  warming.

Green house effect is caused by

  1. Green plants

  2. Infrared rays

  3. UV rays

  4. X-rays


Correct Option: B
Explanation:

When solar radiation enters the atmosphere, it is absorbed by the clouds and gases and heats the earth's surface. The earth, in return, reflects some of this heat into the atmosphere as infrared radiation. Most of this infrared radiation gets absorbed by atmospheric gases such as carbon dioxide, methane, nitrous oxide, and ozone, commonly known as greenhouse gases. These gases send the infrared radiation back to the earth's surface, thereby heating the surface again. This cycle repeats several times, thereby resulting in the greenhouse effect.

So, the correct answer is 'Infrared rays'.

Which of the following contribute to green house effect?

  1. Methane

  2. Carbondioxide

  3. CFCs

  4. All of the above


Correct Option: D
Explanation:

(The greenhouse effect is the natural process by which the atmosphere traps some of the Sun's energy,  warming the Earth enough to support life.  Most mainstream scientists believe a human-driven increase in "greenhouse gases" is increasing the effect artificially.
These gases include carbon dioxide, methane, nitrous oxide, water vapour, CFCs, ozone etc. Ozone in the stratosphere acts as a protective layer, but harmful if it is present in the troposphere).

So, the correct answer is All of the above'.

CDM is 

  1. Clean development mechanism

  2. Clear development machinary

  3. Clean development machine

  4. Clean development movement


Correct Option: A
Explanation:

A national CDM (clean development mechanism) authority has set up in December 2003 to formulate projects for reducing emission of CO$ _2$ and other green house gases. 

A natural phenomenon that becomes harmful due to pollution is _____________.

  1. Global warming

  2. Ecological balance

  3. Greenhouse effect

  4. Desertification


Correct Option: C
Explanation:

Solar radiation is absorbed in the Earth's surface and emitted as thermal energy that can be re-absorbed by greenhouse gases. Greenhouse gases include water vapor, carbon dioxide, ozone, and methane; the major components of atmospheric gas nitrogen, oxygen, and argon are transparent to infrared radiation. The greenhouse effect insulates the earth's surface, making it hospitable to life; however, human activities have increased the concentration of these gases, causing global warming.

So, the correct answer is 'Greenhouse effect'.

Assertion :Green - house effect is due to thick layer of carbon dioxide.

Reason :The glass panels of a green - house allowing the sunlight to filter through but preventing the heat from being re-radiated in outer space.

  1. If both the assertion and the reason are true and the reason is a correct explanation of the assertion

  2. If both the assertion and reason are true but the reason is not a correct explanation of the assertion

  3. If the assertion is true but the reason is false

  4. If both the assertion and reason are false

  5. If the assertion is false but reason is true


Correct Option: B

Which one of the following is not a green house gas?

  1. $CO _2$

  2. $CH _4$

  3. $O _2$

  4. CFCs


Correct Option: C
Explanation:

Greenhouse gases are called so because they are capable of absorbing the insolation from the sun and keeping it within the troposphere, thereby increasing the overall temperature of the earth, called global warming. Carbon dioxide, methane, nitrous oxide, ozone, Chlorofluorocarbons and sulphur hexafluoride are considered to be the potent greenhouse gases. Oxygen is not a greenhouse gas.

Hence, the correct answer is 'O$ _{2}$' 

Surface of earth is kept warm by

  1. Solar radiations

  2. Geothermal energy

  3. Green house flux

  4. Absorption of infra-radiations by green house gases


Correct Option: C
Explanation:

The gases in the troposphere of the atmosphere absorb the sun radiations and trap them so that they do not reflect back. This process allows the heat to remain trapped with in the atmosphere and the earth surface remains warm. This process is called greenhouse effect and the absorbed radiations striking the earth's surface are called green house flux. Carbon dioxide, water vapour, oxides of nitrogen are useful for this purpose. 

Hence, the correct answer is 'Green house flux'.

Green house gases include

  1. $CO _2, CHC, CH _4$ and $N _2O$

  2. $CO _2, O _2, N _2, NO _2$ and $NH _3$

  3. $CH _4, N _2. CO _2$ and $NH _3$

  4. $CFC, CO _2, NH _3$ and $N _2$


Correct Option: A
Explanation:

A greenhouse gas absorb radiation and emit heat energy maintaining the Earth's temperature. However, when released in excess amounts, they cause global warming. Sources are volcanic eruptions, burning of fossil fuels, deforestation, vehicular exhausts, industrial emissions etc. contribute to the greenhouse gases. Carbon dioxide, Chlorinated hydrocarbon (CHC), Methane and oxides of nitrogen are considered to be the major greenhouse gases.

Hence, the correct answer is 'CO$ _{2}$, CHC, CH$ _{4}$ and N$ _{2}$O'

Maximum green house gas released by which country : -

  1. India

  2. France

  3. U.S.A

  4. Britain


Correct Option: C
Explanation:
Maximum greenhouse gas is released by China in the world.
China > USA > Britain > India > France.
So, the correct answer is 'Option C-U.S.A'.

Which is not a green house gas?

  1. Chlorofluorocarbon

  2. Methane

  3. Carbon dioxide

  4. Hydrogen


Correct Option: D
Explanation:
Greenhouse gases cause greenhouse effect by trapping the infrared radiation trying to escape back to space. This process increases the earth’s temperature. Gases which contributes in greenhouse effect are carbon dioxide, methane, nitrous oxide, ozone, water vapour, Chlorofluorocarbons (CFCs) and, Hydrofluorocarbons (HCFCs and HFCs). Hydrogen is not a greenhouse gas.
Hence, the correct answer is ‘Hydrogen’.

Methane gas producing field is

  1. Wheat field

  2. Paddy field

  3. Cotton field

  4. Groundnut field


Correct Option: B
Explanation:

Paddy or the rice fields are water-logged to allow the growth of the rice crops. Due to the respiration, the carbon dioxide is released in heavy amounts by the bacteria present in the water-logged soil. However, as the season progresses, the methane-releasing bacteria are seen to occupy the paddy field. Together with the carbon dioxide, the methane becomes a greenhouse gas resulting in global warming

So, the correct answer is 'Paddy field'

A green house gas is

  1. $H _2$

  2. CO

  3. $CO _2$

  4. $N _2$


Correct Option: C
Explanation:

A greenhouse gas absorb radiation and emit heat energy maintaining the Earth's temperature. Sources are volcanic eruptions, burning of fossil fuels, deforestation, vehicular emission, industrial exhausts etc. which have increased the concentration of carbon dioxide in the atmosphere. The oxygen and hydrogen are transparent gases having symmetrical molecules of identical atoms, unable to rotate and vibrate.

Hence, the correct answer is 'CO$ _{2}$'.

Ozone is

  1. Protector in troposphere

  2. Pollutant in troposphere

  3. Green house gas

  4. Both B and C


Correct Option: D
Explanation:

Ozone is a significant gas in the stratosphere because it absorbs the UV rays and do not allow them to reach the earth's surface. There it is formed by the reaction of oxygen with UV rays. However, tropospheric or ground-level ozone is formed as a secondary pollutant and is harmful. It acts as a major constituent of the photochemical smog. It also traps and reflect back the infra-red rays coming from the earth's surface. Here, it is formed when the primary pollutants react with the oxygen in the presence of sunlight. So, it acts as a greenhouse gas.

Hence, the correct answer is 'Both B and C'.

Substitute of chlorofluorocarbon is

  1. Hydrofluorocarbon

  2. Hydrochlorofluorocarbon

  3. Fluorocarbon

  4. Both A and B


Correct Option: D
Explanation:
Chlorofluorocarbons (CFC) are the chemicals used as refrigerants. They cause ozone depletion as they release chloride radicals which on reacting with ozone causes its degradation.
The chlorofluorocarbons can be substituted by Hydrofluorocarbon (HFC) or Hydrochlorofluorocarbon (HCFC) for using as refrigerants and in air conditioners. Though HFCs and HCFCs also deplete ozone but to lesser extent than CFCs.
Hence, both options A and B are correct.
So, the correct answer is 'Both A and B'.

Green house effect is the cumulative result of the influences of certain gases. Identify the gas which is not involved in this influence?

  1. Methane

  2. Carbon dioxide

  3. Chlorofluorocarbons

  4. Nitrogen


Correct Option: D
Explanation:

Certain gases such as methane, carbon dioxide, chlorofluorocarbons are called greenhouse gases because they absorb and thus trap some of the radiation. The nitrogen is the second most abundant act found in the atmosphere after oxygen. These gases do not have the ability to intercept infrared radiation and hence they do not contribute to causing of the greenhouse effect. Methane, carbon dioxide and chlorofluorocarbons are potent greenhouse gases.

Hence, the correct answer is 'Nitrogen'.

The two gases making highest relative contribution to the green house gases are

  1. $CH _4$ and $N _2O$

  2. CFCs and $N _2O$

  3. $CO _2$ and $NO _2$

  4. $CO _2$ and $CH _4$


Correct Option: D
Explanation:
The gases responsible for green house effect are called green house gases which trap the radiations and don't let them reflect back from the earth's surface. The green house gases are Chlorofluorocarbons (CFC's), Carbon dioxide (CO2), Methane (CH4) and Nitrous Oxide (N2O). 
The approximate percentage of different greenhouse gases in the atmosphere is:
CFCs - 14%
CO2 - 60%
‎CH4 - 20%
N2O - 6%
Hence, CO2 and CH4 have highest relative contribution to green house gases.
So, the correct answer is 'CO2 and CH4'.

At present, the concentration of atmospheric $CO 2$ is ________.

  1. $100$ ppm

  2. $240$ ppm

  3. $380$ ppm

  4. $520$ ppm


Correct Option: C
Explanation:
CO2 is a major pollutant of air and a green house gas that contributes to global warming. Concentration of CO2 in the atmosphere is expressed in terms of parts per million or ppm. According to latest research by forecasting systems, CO2 concentration was found to be about 380 ppm which in recent years has increased upto 400 ppm.
So, the correct answer is '380 ppm'.

Gases responsible for green house effect are

  1. $CO _2$

  2. CFC

  3. $N _2O$

  4. All the above


Correct Option: D
Explanation:

A greenhouse gas is a gas in an atmosphere that absorbs and emits radiant energy within the thermal infrared range. This process is the fundamental cause of the greenhouse effect. The primary greenhouse gases in Earth's atmosphere are water vapour, carbon dioxide, methane, CFC's, nitrous oxide, and ozone.

So the correct answer is 'All the above'.

One GHG contributes $6\%$ to total global warming, other contributes to $20\%$; they are.

  1. $NO _2$ and $CO _2$

  2. $N _2O$ and CFCs

  3. CFCs and methane

  4. $N _2O$ and methane

  5. $CO _2$ and CFCs


Correct Option: D
Explanation:
The relative contribution of various greenhouse gases to total global warming are as follows:
Methane: 20%
CFCs(Chloro-fluoro-carbons): 14%
N$ _2$O: 6%
Carbon dioxide: 60%
So, the correct answer is 'Option D- N$ _2$O and methane'.

Greenhouse gases are

  1. $CO _2$ and $CH _4$

  2. $N _2O$ and CFCs

  3. Ozone

  4. All of the above


Correct Option: D
Explanation:

Carbon dioxide and methane are naturally occurring gases. Nitrous oxides are formed due to denitrification and combustion of the fossil fuels. CFCs are used as refrigerants and propellants. Ozone is formed as a secondary pollutant. All these are greenhouse gases because they show greenhouse effect by absorbing the the long-wavelength infra-red radiations coming from the earth's surface and preventing from leaving the atmosphere. This effect is responsible for maintaining the ambient temperature on the earth. Their  amounts have increased over the past years and this has adversely affected the global temperature by raiding it. This is called global warming and is responsible for climate change. 

Hence, the correct answer is 'All of the above'

Which one of the following statements is not correct?

  1. The greenhouse gases trap out the heal in infra-red radiation

  2. Natural gas supplies five percent f global energy needs

  3. One molecule of CFC can trap as many as $10,000$ molecules of $CO _2$

  4. The atmospheric life time to $CFCl _3$ is estimated at $75$ years


Correct Option: A

Green house gases are called as such because they.

  1. Prevent the escape of heat waves reradiated from the earth's surface

  2. Are produced in greenhouses

  3. Are used in warming plant growth chambers

  4. Help in maintaining atmospheric $O _2$ and $CO _2$ balance


Correct Option: A

Choose the correct answer form the alternatives given.
The second biggest greenhouse gas emitter (after the USA) in the world is:

  1. Russia

  2. Germany

  3. China

  4. Japan


Correct Option: C

Cyclic variations of CO2CO2 concentration in the atmosphere are due to changes in

  1. photosynthetic activity

  2. respiratory activity

  3. burning of fossil fuels

  4. action of infra-red rays


Correct Option: C
Explanation:

The burning of fossil fuels such as gasoline, coal, oil, natural gas in combustion reactions results in the production of carbon dioxide. There are cyclic variations of Carbon dioxide concentration in the atmosphere due to this reason. 

So, the correct optionos 'Burning of fossil fuels'.

Which one of the following is major given house gas?

  1. Freon

  2. $CO _2$

  3. CFC

  4. $NO _2$


Correct Option: B
Explanation:

greenhouse gases are those gases which absorb the heat or thermal infrared radiations of the sun and is responsible for an increase in the temperature of the earth's surface .there are several greenhouse gases that are produced either naturally or is being emitted in the atmosphere by a man-made source. The most abundant or major greenhouse gas is Carbon Dioxide.

so the correct answer is 'CO2'.

Increase in carbon dioxide in atmosphere is harmful because it

  1. traps heat

  2. causes respiratory disorders

  3. forms smog

  4. increases turbidity


Correct Option: A
Explanation:

Carbon dioxide is one of the most abundant and major greenhouse gas which entraps the heat and causes the rise in temperature of the earth surface hence is greatly responsible for global warming also.

so the correct answer is 'traps heat'.

Multiple Choice Questions
Which one is correct percentage of green house gases

  1. Methane - $20\%$, $N _2O $- $18\%$

  2. CFCs -$14\%$, Methane - $20\%$

  3. $CO _2$ - $40\%$, CFCs -$30\%$

  4. $N _2O$ - $6\%. $ $CO _2$ - $86\%$


Correct Option: B
Explanation:

Relative concentration of various greenhouse gases in the atmosphere is as: CO$ _2$ (60%), CH$ _4$ (20%), CFCs (14%) and N$ _2$O (6%).

So, the correct answer is CFCs-14%, Methane 20%.

Identify the wrong statement/ statement from the following.
(1) ${ CO } _{ 2 }$ is released into the atmosphere through volcanic activity
(2)${ CO } _{ 2 }$ is released into the atmosphere through process of photosynthesis
(3)${ CO } _{ 2 }$ is released into the atmosphere through process of respiration
(4)${ CO } _{ 2 }$ is released into the atmosphere through process of forest fires


  1. 1 and 3

  2. only 2

  3. only 4

  4. 2 and 4


Correct Option: B
Explanation:

Oxygen is released in the atmosphere through the process of photosynthesis. Carbon dioxide is released by different human activities like the burning of fossil fuels,  deforestation, burning of petrol etc.

So, the correct option is 'Only 2'.

The legally binding international agreement to reduce Greenhouse gases by 5% 2012 is ___________

  1. Vienna convention

  2. Montreal Protocol

  3. Kyoto Protocol

  4. Ozone Protocol


Correct Option: C

Which of the following gases are mainly responsible for the atmospheric greenhouse effect in the earth's atmosphere?

  1. Oxygen and nitrogen

  2. Nitrogen and carbon dioxide

  3. Ozone and oxygen

  4. Water vapor and carbon dioxide


Correct Option: D

The gas responsible for the greenhouse effect on Venus is:

  1. Carbon dioxide $(CO _{2})$

  2. Oxygen $(O _{2})$

  3. Ozone $(O _{3})$

  4. Nitrogen $(N _{2})$


Correct Option: A

Pick out the potent green house gas

  1. $CO _{2}$

  2. $N _{2}O$

  3. $CH _{4}$

  4. $O _{3}$


Correct Option: C

Green House effect is caused by

  1. Increase in $CO _{2}$

  2. Increase in $O _{2}$

  3. Decrease in $O _{2}$

  4. Decrease in $CO _{2}$


Correct Option: A

Which of the following green house gases trap more heat?

  1. Methane

  2. Nitrous oxide

  3. Carbon dioxide

  4. Trifluoro methyl sulphurpentafluoride


Correct Option: D

What would be average temperature of earth without greenhouse gases?

  1. $90^{o}C$

  2. $70^{o}C$

  3. $10^{o}C$

  4. $18^{c}ircC$


Correct Option: D

Earth's surface temperature can be altered, by changing concentration of

  1. Heat

  2. Greenhouse Gases

  3. Air pollutants

  4. All of above


Correct Option: B

What is the number of Green House Gases, as recognized by the Kyoto Protocol?

  1. 3

  2. 4

  3. 5

  4. 6


Correct Option: D

What is the name of world's first greenhouse-gas-monitoring satellite?

  1. ICESat

  2. Jason-1

  3. Ibuki

  4. NPOESS


Correct Option: C

Which among the following is the most correct statement in context with Carbon footprint?

  1. It is a measure of Green house gas emissions by a product

  2. It is a unit under the Kyoto Protocol representing a reduction of greenhouse gases under the Joint Implementation mechanism

  3. It is a administrative approach used to control pollution by providing economic incentives for achieving reductions in the emissions of pollution

  4. All of above are correct


Correct Option: A

In the year 2009, Japan launched its first satellite to monitor greenhouse gases. What is the name of the satellite?

  1. Tadami

  2. Yasushi

  3. Kyoto

  4. Ibuki


Correct Option: D

Major source of methane in India is

  1. Rice fields

  2. Sugarcane plantation

  3. Wheat fields

  4. Fruit orchards


Correct Option: A
Explanation:

In India, paddy or rice cultivation is done across the different regions and in different seasons. The availability of the monsoon and irrigation facility further promote the paddy cultivation. The paddy cultivation occurs in water logged condition and favours the release of methane after the bacteria has respired aerobically. So, the methane release in the country is largely due to the rice fields. Sugarcane plantations, wheat fields and fruit orchard do not need water-logged condition.

So, the correct answer is 'Rice fields'

Gas being produced by paddy fields and involved in global warming is

  1. Chlorine

  2. Methane

  3. $CO _2$

  4. $H _2S$


Correct Option: B
Explanation:

The microbes in the paddy field respire and release the carbon dioxide. The increase in carbon dioxide increases the nearby temperature. This further results in the release of methane. Methane, in combination with carbon dioxide becomes a potent greenhouse gas. They trap the sun radiations, preventing them from reflecting back and falling on the earth's surface. This results in raising the overall global temperature. 

Hence, the correct answer is 'Methane'.

Which green-house gas other than methane is being produced by agricultural fields?

  1. Nitrous oxide

  2. Ammonia

  3. Sulphur dioxide

  4. Arsenic


Correct Option: A
Explanation:

Nitrous oxide is a powerful greenhouse gas produced by soil cultivation practices, especially the use of commercial organic fertilizers (including manure), biomass burning etc, This is done by a process of nitrification which converts the nitrogen in fertilizer to the production of nitrous oxide. The excessive use of the fertilizers thereby results in an increase in the nitrous oxide production.

Hence, the correct answer is 'Nitrous oxide'.

$CO _2, CH _4, N _2O, CFCs$ are called green house gases because they can absorb

  1. Ultraviolet radiations

  2. Long wave infra-red radiations

  3. Visible light radiation

  4. X-ray radiation

  5. $\gamma$-ray radiation


Correct Option: B
Explanation:

The greenhouse gases are called so because they absorb the long wave infra-red radiations reflected from the earth's surface and trap them such that they do not get reflected back to space. This trapping of the long wave infra-red radiations causes an increase in the temperature of the atmosphere, called global warming. CO$ _{2}$, CH$ _{4}$, N$ _{2}$O, CFCs are the gases that are capable of showing greenhouse effect. These have increased in the concentration over the years due to the anthropogenic activities.

Hence, the correct answer is 'Long wave infra-red radiations'.

What is relative contribution of $CO _2, CH _4$, CFC and $N _2O$ to global warming?

  1. $20\%, 14\%, 60\%, 6\%$

  2. $14\%, 6\%, 20\%, 60\%$

  3. $60\%, 20\%, 14\%, 6\%$

  4. $6\%, 14\%, 20\%, 60\%$

  5. $20\%, 60\%, 14\%, 6\%$


Correct Option: C
Explanation:

Global warming potential (GWP) is a measure of how much heat a greenhouse gas traps in the atmosphere up to a specific time horizon, relative to carbon dioxide. It compares the amount of heat trapped by a certain mass of the gas in question to the amount of heat trapped by a similar mass of carbon dioxide and is expressed as a factor of carbon dioxide an index of global warming potential for methane, carbon monoxide, nitrous oxide and CFCs relative to that of carbon dioxide. The major contribution is from CO$ _2$ (60%),CH$ _4$ (20%), CFC and N$ _2$O attributes to 14% and 6% respectively.

So the correct answer is '60%,20%,14%,6%'.

- Hide questions